| product Name |
2,5-Dihydroxy-1,4-benzoquinone |
| Synonyms |
2,5-Dihydroxybenzoquinone; 2,5-dihydroxycyclohexa-2,5-diene-1,4-dione |
| Molecular Formula |
C6H4O4 |
| Molecular Weight |
140.0936 |
| InChI |
InChI=1/C6H4O4/c7-3-1-4(8)6(10)2-5(3)9/h1-2,7,10H |
| CAS Registry Number |
615-94-1 |
| EINECS |
210-454-3 |
| Molecular Structure |
|
| Density |
1.843g/cm3 |
| Melting point |
220℃ |
| Boiling point |
322.3°C at 760 mmHg |
| Refractive index |
1.729 |
| Flash point |
162.9°C |
| Vapour Pressur |
2.24E-05mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
|
