| product Name |
2-Bromo-4-methylacetanilide |
| Synonyms |
2-Bromo-4-methylactanilide; N-(2-bromo-4-methylphenyl)acetamide |
| Molecular Formula |
C9H10BrNO |
| Molecular Weight |
228.0858 |
| InChI |
InChI=1/C9H10BrNO/c1-6-3-4-9(8(10)5-6)11-7(2)12/h3-5H,1-2H3,(H,11,12) |
| CAS Registry Number |
614-83-5 |
| Molecular Structure |
|
| Density |
1.471g/cm3 |
| Melting point |
117-119℃ |
| Boiling point |
349.9°C at 760 mmHg |
| Refractive index |
1.6 |
| Flash point |
165.4°C |
| Vapour Pressur |
4.57E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
