product Name |
2'-Bromoacetanilide |
Synonyms |
2-Bromoacetanilide; N-(2-bromophenyl)acetamide |
Molecular Formula |
C8H8BrNO |
Molecular Weight |
214.0592 |
InChI |
InChI=1/C8H8BrNO/c1-6(11)10-8-5-3-2-4-7(8)9/h2-5H,1H3,(H,10,11) |
CAS Registry Number |
614-76-6 |
Molecular Structure |
|
Density |
1.543g/cm3 |
Melting point |
96.5-100.5℃ |
Boiling point |
346.8°C at 760 mmHg |
Refractive index |
1.611 |
Flash point |
163.5°C |
Vapour Pressur |
5.62E-05mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|