product Name |
Cinnamylideneacetophenone |
Synonyms |
5-phenylpenta-2,4-dienophenone; 1,5-Diphenyl-2,4-pentadien-1-one~5-Phenyl-2,4-pentadienophenone; 1,5-diphenylpenta-2,4-dien-1-one; (2E,4E)-1,5-diphenylpenta-2,4-dien-1-one |
Molecular Formula |
C17H14O |
Molecular Weight |
234.2925 |
InChI |
InChI=1/C17H14O/c18-17(16-12-5-2-6-13-16)14-8-7-11-15-9-3-1-4-10-15/h1-14H/b11-7+,14-8+ |
CAS Registry Number |
614-57-3 |
EINECS |
210-385-9 |
Molecular Structure |
|
Density |
1.082g/cm3 |
Melting point |
100-102℃ |
Boiling point |
388.1°C at 760 mmHg |
Refractive index |
1.624 |
Flash point |
169.6°C |
Vapour Pressur |
3.15E-06mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|