| product Name |
P-tolyl benzoate |
| Synonyms |
p-Tolyl benzoate (Benzoic acid p-tolyl ester); Benzoic acid p-tolyl ester; 4-methylphenyl benzoate |
| Molecular Formula |
C14H12O2 |
| Molecular Weight |
212.2439 |
| InChI |
InChI=1/C14H12O2/c1-11-7-9-13(10-8-11)16-14(15)12-5-3-2-4-6-12/h2-10H,1H3 |
| CAS Registry Number |
614-34-6 |
| EINECS |
210-380-1 |
| Molecular Structure |
|
| Density |
1.122g/cm3 |
| Melting point |
70-72℃ |
| Boiling point |
316.6°C at 760 mmHg |
| Refractive index |
1.577 |
| Flash point |
130.1°C |
| Vapour Pressur |
0.000407mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
