| product Name |
4-(2-Methylphenyl)-3-thiosemicarbazide |
| Synonyms |
4-(o-Tolyl)-3-thiosemicarbazide; N-(2-methylphenyl)hydrazinecarbothioamide; 2-(2-methylphenyl)hydrazinecarbothioamide |
| Molecular Formula |
C8H11N3S |
| Molecular Weight |
181.258 |
| InChI |
InChI=1/C8H11N3S/c1-6-4-2-3-5-7(6)10-11-8(9)12/h2-5,10H,1H3,(H3,9,11,12) |
| CAS Registry Number |
614-10-8 |
| Molecular Structure |
|
| Density |
1.27g/cm3 |
| Boiling point |
295.9°C at 760 mmHg |
| Refractive index |
1.699 |
| Flash point |
132.8°C |
| Vapour Pressur |
0.00148mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R25:Toxic if swallowed.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
