product Name |
N'-hydroxybenzenecarboximidamide |
Synonyms |
Benzamidoxime |
Molecular Formula |
C7H8N2O |
Molecular Weight |
136.1512 |
InChI |
InChI=1/C7H8N2O/c8-7(9-10)6-4-2-1-3-5-6/h1-5,10H,(H2,8,9) |
CAS Registry Number |
613-92-3 |
EINECS |
210-361-8 |
Molecular Structure |
|
Density |
1.18g/cm3 |
Melting point |
60℃ |
Boiling point |
307.4°C at 760 mmHg |
Refractive index |
1.574 |
Flash point |
139.7°C |
Vapour Pressur |
0.000315mmHg at 25°C |
Hazard Symbols |
Xn:Harmful;
|
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|