product Name |
di-2-naphthyl ether |
Synonyms |
Dinaphthylether; 2,2-Dinaphthyl ether; 2-Naphthyl ether; 2,2'-oxydinaphthalene |
Molecular Formula |
C20H14O |
Molecular Weight |
270.3246 |
InChI |
InChI=1/C20H14O/c1-3-7-17-13-19(11-9-15(17)5-1)21-20-12-10-16-6-2-4-8-18(16)14-20/h1-14H |
CAS Registry Number |
613-80-9 |
EINECS |
210-356-0 |
Molecular Structure |
|
Density |
1.184g/cm3 |
Boiling point |
449.9°C at 760 mmHg |
Refractive index |
1.701 |
Flash point |
226.1°C |
Vapour Pressur |
7.3E-08mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|