| product Name |
BENZYL-2-NAPHTHYLETHER |
| Synonyms |
BETA-NAPHTHYLBENZYLETHER (BON); 2-(phenylmethoxy)naphthalene; nbe; NIPAFAX BNE SENSLON-50; 2-(benzyloxy)naphthalene; 2-Benzyloxynaphthalene |
| Molecular Formula |
C17H14O |
| Molecular Weight |
234.2925 |
| InChI |
InChI=1/C17H14O/c1-2-6-14(7-3-1)13-18-17-11-10-15-8-4-5-9-16(15)12-17/h1-12H,13H2 |
| CAS Registry Number |
613-62-7 |
| EINECS |
405-490-3 |
| Molecular Structure |
|
| Density |
1.125g/cm3 |
| Boiling point |
388.1°C at 760 mmHg |
| Refractive index |
1.642 |
| Flash point |
156.4°C |
| Vapour Pressur |
7.02E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R53:May cause long-term adverse effects in the aquatic environment.;
|
| Safety Description |
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|