product Name |
alpha-Bromo-2'-acetonaphthone |
Synonyms |
Bromomethyl 2-naphthyl ketone; alpha-Bromo-2-acetonaphthone~2-(Bromoacetyl)naphthalene; 2-(Bromoacetyl)naphthalene; 2-bromo-1-(naphthalen-2-yl)ethanone; α-Bromo-2-acetonaphthone |
Molecular Formula |
C12H9BrO |
Molecular Weight |
249.1033 |
InChI |
InChI=1/C12H9BrO/c13-8-12(14)11-6-5-9-3-1-2-4-10(9)7-11/h1-7H,8H2 |
CAS Registry Number |
613-54-7 |
EINECS |
210-348-7 |
Molecular Structure |
|
Density |
1.48g/cm3 |
Melting point |
82-85℃ |
Boiling point |
349.8°C at 760 mmHg |
Refractive index |
1.656 |
Flash point |
99.1°C |
Vapour Pressur |
4.59E-05mmHg at 25°C |
Hazard Symbols |
C:Corrosive;
|
Risk Codes |
R34:Causes burns.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|