| product Name |
9,10-Dihydroanthracene |
| Synonyms |
AI3-09026; Anthracene, dihydro-; NSC 30805; Anthracene, 9,10-dihydro- |
| Molecular Formula |
C14H12 |
| Molecular Weight |
180.2451 |
| InChI |
InChI=1/C14H12/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-8H,9-10H2 |
| CAS Registry Number |
613-31-0 |
| EINECS |
210-336-1 |
| Molecular Structure |
|
| Density |
1.085g/cm3 |
| Melting point |
104-107℃ |
| Boiling point |
305°C at 760 mmHg |
| Refractive index |
1.62 |
| Flash point |
131.8°C |
| Vapour Pressur |
0.00152mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|