| product Name |
2-methylquinolin-6-ol |
| Synonyms |
6-Hydroxy-2-methylquinoline |
| Molecular Formula |
C10H9NO |
| Molecular Weight |
159.1846 |
| InChI |
InChI=1/C10H9NO/c1-7-2-3-8-6-9(12)4-5-10(8)11-7/h2-6,12H,1H3 |
| CAS Registry Number |
613-21-8 |
| Molecular Structure |
|
| Density |
1.21g/cm3 |
| Melting point |
198℃ |
| Boiling point |
304.5°C at 760 mmHg |
| Refractive index |
1.666 |
| Flash point |
142.3°C |
| Vapour Pressur |
0.000483mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
