| product Name |
2-Aminoanthracene |
| Synonyms |
2-anthramine practical grade*crystalline; 2-anthrylamine
; 2-Anthramine; 2-Anthranamine; anthracen-2-amine |
| Molecular Formula |
C14H11N |
| Molecular Weight |
193.2438 |
| InChI |
InChI=1/C14H11N/c15-14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14/h1-9H,15H2 |
| CAS Registry Number |
613-13-8 |
| EINECS |
210-330-9 |
| Molecular Structure |
|
| Density |
1.208g/cm3 |
| Melting point |
238-241℃ |
| Boiling point |
414.2°C at 760 mmHg |
| Refractive index |
1.765 |
| Flash point |
229°C |
| Vapour Pressur |
4.52E-07mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R33:Danger of cummulative effects.;
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
