| product Name |
1,2,4-Triacetoxybenzene |
| Synonyms |
1,2,4-Phenenyl triacetate; benzene-1,2,4-triyl triacetate; 2-[(1-hydroxyethenyl)oxy]benzene-1,4-diyl diacetate |
| Molecular Formula |
C12H12O6 |
| Molecular Weight |
252.2201 |
| InChI |
InChI=1/C12H12O6/c1-7(13)16-10-4-5-11(17-8(2)14)12(6-10)18-9(3)15/h4-6,15H,3H2,1-2H3 |
| CAS Registry Number |
613-03-6 |
| EINECS |
210-327-2 |
| Molecular Structure |
|
| Density |
1.276g/cm3 |
| Melting point |
98-100℃ |
| Boiling point |
401°C at 760 mmHg |
| Refractive index |
1.533 |
| Flash point |
153.2°C |
| Vapour Pressur |
3.77E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|