product Name |
2-Nitrosotoluene |
Synonyms |
1-Methyl-2-nitrosobenzene; 2-Methyl-1-nitrosobenzene; 2-Methylnitrosobenzene; 4-05-00-00844 (Beilstein Handbook Reference); BRN 1927295; CCRIS 480; NSC 66507; o-Methylnitrosobenzene; o-Nitrosotoluene; Benzene, 1-methyl-2-nitroso- (9CI); Toluene, o-nitroso- |
Molecular Formula |
C7H7NO |
Molecular Weight |
121.1366 |
InChI |
InChI=1/C7H7NO/c1-6-4-2-3-5-7(6)8-9/h2-5H,1H3 |
CAS Registry Number |
611-23-4 |
EINECS |
210-261-4 |
Molecular Structure |
|
Density |
1.03g/cm3 |
Melting point |
70-75℃ |
Boiling point |
199.9°C at 760 mmHg |
Refractive index |
1.524 |
Flash point |
74.7°C |
Vapour Pressur |
0.472mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|