| product Name |
3-Methyl-4-nitroaniline |
| Synonyms |
3-Amino-6-nitrotoluene~4-Nitro-m-toluidine; 4-Nitro-m-toluidine (NH2=1) |
| Molecular Formula |
C7H8N2O2 |
| Molecular Weight |
152.1506 |
| InChI |
InChI=1/C7H8N2O2/c1-5-4-6(8)2-3-7(5)9(10)11/h2-4H,8H2,1H3 |
| CAS Registry Number |
611-05-2 |
| EINECS |
210-247-8 |
| Molecular Structure |
|
| Density |
1.269g/cm3 |
| Boiling point |
330°C at 760 mmHg |
| Refractive index |
1.615 |
| Flash point |
153.4°C |
| Vapour Pressur |
0.000171mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
| Safety Description |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|
