product Name |
Ethyl 2-nitrobenzoate |
Synonyms |
2-Nitrobenzoic acid ethyl ester |
Molecular Formula |
C9H9NO4 |
Molecular Weight |
195.1721 |
InChI |
InChI=1/C9H9NO4/c1-2-14-9(11)7-5-3-4-6-8(7)10(12)13/h3-6H,2H2,1H3 |
CAS Registry Number |
610-34-4 |
EINECS |
210-220-0 |
Molecular Structure |
|
Density |
1.253g/cm3 |
Melting point |
26-174℃ |
Boiling point |
275°C at 760 mmHg |
Refractive index |
1.544 |
Flash point |
126.1°C |
Vapour Pressur |
0.00523mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|