| product Name |
2-Nitrobenzamide |
| Synonyms |
Benzamide, o-nitro-; 2-Carbamoylnitrobenzene; 4-09-00-01049 (Beilstein Handbook Reference); BRN 1950928; NSC 407995; o-Nitrobenzamide; Benzamide, 2-nitro-; Benzamide, 2-nitro- (9CI) |
| Molecular Formula |
C7H6N2O3 |
| Molecular Weight |
166.1341 |
| InChI |
InChI=1/C7H6N2O3/c8-7(10)5-3-1-2-4-6(5)9(11)12/h1-4H,(H2,8,10) |
| CAS Registry Number |
610-15-1 |
| EINECS |
210-208-5 |
| Molecular Structure |
|
| Density |
1.385g/cm3 |
| Melting point |
174-178℃ |
| Boiling point |
317.864°C at 760 mmHg |
| Refractive index |
1.612 |
| Flash point |
146.039°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
