product Name |
2-Iodo-m-xylene |
Molecular Formula |
C8H9I |
Molecular Weight |
232.0615 |
InChI |
InChI=1/C8H9I/c1-6-4-3-5-7(2)8(6)9/h3-5H,1-2H3 |
CAS Registry Number |
608-28-6 |
EINECS |
210-158-4 |
Molecular Structure |
|
Density |
1.61g/cm3 |
Boiling point |
227.5°C at 760 mmHg |
Refractive index |
1.592 |
Flash point |
98.1°C |
Water solubility |
insoluble |
Vapour Pressur |
0.116mmHg at 25°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection;
|
|