product Name |
4-Chloro-1-naphthol |
Synonyms |
1-Chloro-4-hydroxynaphthalene; 4-Chloro-alpha-naphthol; NSC 44345; 1-Naphthalenol, 4-chloro-; 1-Naphthol, 4-chloro- (8CI); 4-chloronaphthalen-1-ol |
Molecular Formula |
C10H7ClO |
Molecular Weight |
178.615 |
InChI |
InChI=1/C10H7ClO/c11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-6,12H |
CAS Registry Number |
604-44-4 |
EINECS |
210-068-5 |
Molecular Structure |
|
Density |
1.333g/cm3 |
Melting point |
117-120℃ |
Boiling point |
332.1°C at 760 mmHg |
Refractive index |
1.684 |
Flash point |
154.6°C |
Vapour Pressur |
7.74E-05mmHg at 25°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|