| product Name |
Aurin |
| Synonyms |
C.I. 43800; Aurin; 4-[bis(4-hydroxyphenyl)methylidene]cyclohexa-2,5-dien-1-one |
| Molecular Formula |
C19H14O3 |
| Molecular Weight |
290.3127 |
| InChI |
InChI=1/C19H14O3/c20-16-7-1-13(2-8-16)19(14-3-9-17(21)10-4-14)15-5-11-18(22)12-6-15/h1-12,20-21H |
| CAS Registry Number |
603-45-2 |
| EINECS |
210-041-8 |
| Molecular Structure |
|
| Density |
1.315g/cm3 |
| Boiling point |
543°C at 760 mmHg |
| Refractive index |
1.691 |
| Flash point |
296.2°C |
| Vapour Pressur |
2.11E-12mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|