| product Name |
7-(B-hydroxypropyl)theophylline |
| Synonyms |
7-(2-hydroxypropyl)theophylline; Proxyphylline; 7-(2-hydroxypropyl)-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione |
| Molecular Formula |
C10H14N4O3 |
| Molecular Weight |
238.2432 |
| InChI |
InChI=1/C10H14N4O3/c1-6(15)4-14-5-11-8-7(14)9(16)13(3)10(17)12(8)2/h5-6,15H,4H2,1-3H3 |
| CAS Registry Number |
603-00-9 |
| EINECS |
210-028-7 |
| Molecular Structure |
|
| Density |
1.46g/cm3 |
| Boiling point |
487.2°C at 760 mmHg |
| Refractive index |
1.664 |
| Flash point |
248.5°C |
| Vapour Pressur |
2.63E-10mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|