| product Name |
Pentafluorobenzoic acid |
| Synonyms |
1-PHENYLSULPHONYL-6-BROMOINDOLE; 1-PHENYLSULPHONYLINDOLE-5-CARBOXYLIC ACID; 2,3,4,5,6-Pentafluoro Benzoic Acid; pentafluorobenzoate; (2-fluoro-4-methoxycarbonyl-phenyl)boronic acid |
| Molecular Formula |
C8H8BFO4 |
| Molecular Weight |
197.9561 |
| InChI |
InChI=1/C8H8BFO4/c1-14-8(11)5-2-3-6(9(12)13)7(10)4-5/h2-4,12-13H,1H3 |
| CAS Registry Number |
602-94-8 |
| EINECS |
210-026-6 |
| Molecular Structure |
|
| Density |
1.33g/cm3 |
| Melting point |
100-104℃ |
| Boiling point |
355.1°C at 760 mmHg |
| Refractive index |
1.513 |
| Flash point |
168.6°C |
| Vapour Pressur |
1.17E-05mmHg at 25°C |
| Hazard Symbols |
T:Toxic;
|
| Risk Codes |
R25:;
R36/37/38:;
|
| Safety Description |
S26:;
S36/37/39:;
S45:;
|
|