| product Name |
2-(diphenylmethyl)benzoic acid |
| Synonyms |
|
| Molecular Formula |
C20H16O2 |
| Molecular Weight |
288.3398 |
| InChI |
InChI=1/C20H16O2/c21-20(22)18-14-8-7-13-17(18)19(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14,19H,(H,21,22) |
| CAS Registry Number |
602-50-6 |
| Molecular Structure |
|
| Density |
1.175g/cm3 |
| Boiling point |
447.1°C at 760 mmHg |
| Refractive index |
1.626 |
| Flash point |
207.2°C |
| Vapour Pressur |
8.9E-09mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|