| product Name |
2,2',4,4',5,5'-hexahydroxy-7,7'-dimethyl-1,1'-bianthracene-9,9',10,10'-tetrone |
| Synonyms |
[1,1'-bianthracene]-9,9',10,10'-tetrone, 2,2',4,4',5,5'-hexahydroxy-7,7'-dimethyl-; 2,2',4,4',5,5'-Hexahydroxy-7,7'-dimethyl-1,1'-bianthracene-9,9',10,10'-tetrone |
| Molecular Formula |
C30H18O10 |
| Molecular Weight |
538.4579 |
| InChI |
InChI=1/C30H18O10/c1-9-3-11-19(13(31)5-9)29(39)23-17(35)7-15(33)21(25(23)27(11)37)22-16(34)8-18(36)24-26(22)28(38)12-4-10(2)6-14(32)20(12)30(24)40/h3-8,31-36H,1-2H3 |
| CAS Registry Number |
32101-26-1;602-06-2 |
| Molecular Structure |
|
| Density |
1.698g/cm3 |
| Boiling point |
956.1°C at 760 mmHg |
| Refractive index |
1.808 |
| Flash point |
545.8°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|