| product Name |
Nandrolone cypionate |
| Synonyms |
Estr-4-en-3-one, 17-beta-hydroxy-, 3-cyclopentylpropionate (ester); 17-beta-Hydroxyestr-4-en-3-one 3-cyclopentylpropionate (ester); 19-Nortestosterone cyclopenytlpropionate; 4-09-00-00048 (Beilstein Handbook Reference); BRN 3172801; NSC 40578; Nortestosterone cypionate; 17beta-Hydroxyestr-4-en-3-one 17-(3-cyclopentylpropionate); Estr-4-en-3-one, 17-(3-cyclopentyl-1-oxopropoxy)-, (17beta)- (9CI); Estr-4-en-3-one, 17beta-hydroxy-, cyclopentanepropionate (8CI); 3-oxoestr-4-en-17-yl 3-cyclopentylpropanoate; (17beta)-3-oxoestr-4-en-17-yl 3-cyclopentylpropanoate |
| Molecular Formula |
C26H38O3 |
| Molecular Weight |
398.5781 |
| InChI |
InChI=1/C26H38O3/c1-26-15-14-21-20-10-8-19(27)16-18(20)7-9-22(21)23(26)11-12-24(26)29-25(28)13-6-17-4-2-3-5-17/h16-17,20-24H,2-15H2,1H3/t20-,21+,22+,23-,24-,26-/m0/s1 |
| CAS Registry Number |
601-63-8 |
| EINECS |
210-006-7 |
| Molecular Structure |
|
| Density |
1.11g/cm3 |
| Boiling point |
525°C at 760 mmHg |
| Refractive index |
1.548 |
| Flash point |
224.8°C |
| Vapour Pressur |
4.09E-11mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|