| product Name |
N-methyl-dl-alanine |
| Synonyms |
N-Me-DL-Ala-OH; Methylalanine; N-methylalanine; N-methyl-L-alanine |
| Molecular Formula |
C4H9NO2 |
| Molecular Weight |
103.1198 |
| InChI |
InChI=1/C4H9NO2/c1-3(5-2)4(6)7/h3,5H,1-2H3,(H,6,7)/t3-/m0/s1 |
| CAS Registry Number |
600-21-5 |
| Molecular Structure |
|
| Density |
1.048g/cm3 |
| Boiling point |
190.1°C at 760 mmHg |
| Refractive index |
1.435 |
| Flash point |
68.8°C |
| Vapour Pressur |
0.244mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|