| product Name |
2-chlorocrotonic acid |
| Synonyms |
2-Chlorocrotonic acid; 2-chlorobut-2-enoic acid; (2E)-2-chlorobut-2-enoic acid |
| Molecular Formula |
C4H5ClO2 |
| Molecular Weight |
120.5343 |
| InChI |
InChI=1/C4H5ClO2/c1-2-3(5)4(6)7/h2H,1H3,(H,6,7)/b3-2+ |
| CAS Registry Number |
600-13-5 |
| Molecular Structure |
|
| Density |
1.282g/cm3 |
| Boiling point |
213.1°C at 760 mmHg |
| Refractive index |
1.484 |
| Flash point |
82.7°C |
| Vapour Pressur |
0.0654mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|