| product Name |
2,3-dichloropentane |
| Synonyms |
Pentane, 2,3-dichloro-; 2,3-Dichloropentane |
| Molecular Formula |
C5H10Cl2 |
| Molecular Weight |
141.0389 |
| InChI |
InChI=1/C5H10Cl2/c1-3-5(7)4(2)6/h4-5H,3H2,1-2H3 |
| CAS Registry Number |
600-11-3 |
| EINECS |
209-983-2 |
| Molecular Structure |
|
| Density |
1.047g/cm3 |
| Boiling point |
137.7°C at 760 mmHg |
| Refractive index |
1.43 |
| Flash point |
35.9°C |
| Vapour Pressur |
8.66mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|