| product Name |
2,3-Dibromopropionic acid |
| Synonyms |
2,3-dibromoproanoic acid; 2,3-dibromopropanoic acid; (2S)-2,3-dibromopropanoic acid; (2S)-2,3-dibromopropanoate; (2R)-2,3-dibromopropanoate |
| Molecular Formula |
C3H3Br2O2 |
| Molecular Weight |
230.8633 |
| InChI |
InChI=1/C3H4Br2O2/c4-1-2(5)3(6)7/h2H,1H2,(H,6,7)/p-1/t2-/m0/s1 |
| CAS Registry Number |
600-05-5 |
| EINECS |
209-981-1 |
| Molecular Structure |
|
| Melting point |
63-66℃ |
| Boiling point |
271.6°C at 760 mmHg |
| Flash point |
118.1°C |
| Vapour Pressur |
0.00179mmHg at 25°C |
| Hazard Symbols |
C:Corrosive;
|
| Risk Codes |
R34:;
|
| Safety Description |
S26:;
S36/37/39:;
S45:;
|
|