product Name |
DL-threo-3-Phenylserine hydrate |
Synonyms |
3-Phenylserine monohydrate; DL-?-Phenylserine threoform DL-Threo-?-phenylserine; β-hydroxyphenylalanine hydrate (1:1) |
Molecular Formula |
C9H13NO4 |
Molecular Weight |
199.2038 |
InChI |
InChI=1/C9H11NO3.H2O/c10-7(9(12)13)8(11)6-4-2-1-3-5-6;/h1-5,7-8,11H,10H2,(H,12,13);1H2 |
CAS Registry Number |
69-96-5 |
EINECS |
200-721-2 |
Molecular Structure |
|
Melting point |
186℃ |
Boiling point |
483.1°C at 760 mmHg |
Flash point |
246°C |
Vapour Pressur |
3.8E-10mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|