| product Name |
Benziodarone |
| Synonyms |
Amplivix; Benzoiodarone; Dilafurane; Dila-Vasal; Cardivix; Corofam; Coronal-Crinos; Retrangor; (2-ethyl-1-benzofuran-3-yl)(4-hydroxy-3,5-diiodophenyl)methanone |
| Molecular Formula |
C17H12I2O3 |
| Molecular Weight |
518.0843 |
| InChI |
InChI=1/C17H12I2O3/c1-2-13-15(10-5-3-4-6-14(10)22-13)16(20)9-7-11(18)17(21)12(19)8-9/h3-8,21H,2H2,1H3 |
| CAS Registry Number |
68-90-6 |
| EINECS |
200-695-2 |
| Molecular Structure |
|
| Density |
1.993g/cm3 |
| Boiling point |
518.2°C at 760 mmHg |
| Refractive index |
1.727 |
| Flash point |
267.2°C |
| Vapour Pressur |
2.35E-11mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|