| product Name |
hydroxyzine |
| Synonyms |
2-(2-(4-(4-chlorobenzhydryl)piperazin-1-yl)ethoxy)ethanol |
| Molecular Formula |
C21H27ClN2O2 |
| Molecular Weight |
374.91 |
| InChI |
InChI=1/C21H27ClN2O2/c22-20-8-6-19(7-9-20)21(18-4-2-1-3-5-18)24-12-10-23(11-13-24)14-16-26-17-15-25/h1-9,21,25H,10-17H2 |
| CAS Registry Number |
68-88-2 |
| EINECS |
200-693-1 |
| Molecular Structure |
|
| Melting point |
190℃ |
| Water solubility |
< 700 mg/mL |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|