| product Name |
5,6-dihydroxyphenazin-1(5H)-one 10-oxide |
| Synonyms |
|
| Molecular Formula |
C12H8N2O4 |
| Molecular Weight |
244.2029 |
| InChI |
InChI=1/C12H8N2O4/c15-9-5-1-3-7-11(9)14(18)8-4-2-6-10(16)12(8)13(7)17/h1-6,15,18H |
| CAS Registry Number |
68-81-5 |
| Molecular Structure |
|
| Density |
1.7g/cm3 |
| Boiling point |
557.8°C at 760 mmHg |
| Refractive index |
1.82 |
| Flash point |
291.1°C |
| Vapour Pressur |
2.81E-13mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|