| product Name |
Mercaptoacetic acid |
| Synonyms |
Thioglycolic acid solution; thioglycolic acid free acid; Thioglycollic acid; Thioglycolic acid; Thioglypollic Acid; sulfanylacetate |
| Molecular Formula |
C2H4O2S |
| Molecular Weight |
92.1096 |
| InChI |
InChI=1/C2H4O2S/c3-2(4)1-5/h5H,1H2,(H,3,4)/p-1 |
| CAS Registry Number |
68-11-1 |
| EINECS |
200-677-4 |
| Molecular Structure |
|
| Melting point |
-16℃ |
| Boiling point |
225.5°C at 760 mmHg |
| Flash point |
99.8°C |
| Water solubility |
soluble |
| Vapour Pressur |
0.0314mmHg at 25°C |
| Hazard Symbols |
T+:Very toxic;
|
| Risk Codes |
R24/25:;
R26:;
R34:;
|
| Safety Description |
S23:;
S25:;
S27:;
S28C:;
S36/37:;
S45:;
|
|