| product Name |
Acetone |
| Synonyms |
2-Propanone; dimethylketal; Dimethyl ketone; beta-ketopropane; chevron acetone; ketone propane; Methyl ketone; Propanone; pyroacetic acid; pyroacetic ether |
| Molecular Formula |
C3H6O |
| Molecular Weight |
58.08 |
| InChI |
InChI=1/C3H6O/c1-3(2)4/h1-2H3 |
| CAS Registry Number |
67-64-1 |
| EINECS |
200-662-2 |
| Molecular Structure |
|
| Density |
0.79 |
| Melting point |
-95℃ |
| Boiling point |
56℃ |
| Refractive index |
1.3585 |
| Flash point |
-20℃ |
| Water solubility |
soluble |
| Hazard Symbols |
F:Flammable;
Xi:Irritant;
|
| Risk Codes |
R11:;
R36:;
R66:;
R67:;
|
| Safety Description |
S16:;
S26:;
S9:;
|
|