| product Name |
Dicumarol |
| Molecular Formula |
C19H12O6 |
| Molecular Weight |
336.295 |
| InChI |
InChI=1/C19H12O6/c20-16-10-5-1-3-7-14(10)24-18(22)12(16)9-13-17(21)11-6-2-4-8-15(11)25-19(13)23/h1-8,20-21H,9H2 |
| CAS Registry Number |
66-76-2 |
| EINECS |
200-632-9 |
| Molecular Structure |
|
| Density |
1.573g/cm3 |
| Melting point |
290-292℃ |
| Boiling point |
620.702°C at 760 mmHg |
| Refractive index |
1.731 |
| Flash point |
231.949°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
T:Toxic;
N:Dangerous for the environment;
|
| Risk Codes |
R22:Harmful if swallowed.;
R48/25:Toxic : danger of serious damage to health by prolonged exposure if swallowed.;
R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
| Safety Description |
S37:Wear suitable gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|