| product Name |
N,N-diethyl-2-{4-[2-(4-methoxyphenyl)-1H-inden-3-yl]phenoxy}ethanamine hydrochloride (1:1) |
| Synonyms |
|
| Molecular Formula |
C28H32ClNO2 |
| Molecular Weight |
450.0122 |
| InChI |
InChI=1/C28H31NO2.ClH/c1-4-29(5-2)18-19-31-25-16-12-22(13-17-25)28-26-9-7-6-8-23(26)20-27(28)21-10-14-24(30-3)15-11-21;/h6-17H,4-5,18-20H2,1-3H3;1H |
| CAS Registry Number |
64-91-5 |
| Molecular Structure |
|
| Boiling point |
528.9°C at 760 mmHg |
| Flash point |
153°C |
| Vapour Pressur |
2.85E-11mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|