| product Name |
4-(3-azaspiro[5.6]dodec-3-yl)-1-(4-fluorophenyl)butan-1-one |
| Synonyms |
|
| Molecular Formula |
C21H30FNO |
| Molecular Weight |
331.4674 |
| InChI |
InChI=1/C21H30FNO/c22-19-9-7-18(8-10-19)20(24)6-5-15-23-16-13-21(14-17-23)11-3-1-2-4-12-21/h7-10H,1-6,11-17H2 |
| CAS Registry Number |
64-57-3 |
| Molecular Structure |
|
| Density |
1.08g/cm3 |
| Boiling point |
463.5°C at 760 mmHg |
| Refractive index |
1.54 |
| Flash point |
234.1°C |
| Vapour Pressur |
9.01E-09mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|