| product Name |
1-(4-methoxybenzyl)ethylamine |
| Synonyms |
4-Methoxyamphetamine; (+-)-1-(p-Methoxyphenyl)-2-aminopropane; (+-)-4-Methoxyamphetamine; (+-)-p-Methoxy-alpha-methylphenylethylamine; (+-)-p-Methoxyamphetamine; 1-p-Methoxyphenyl-2-aminopropane; 1-p-Methoxyphenyl-2-propylamine; 2-Amino-1-(4'-methoxyphenyl)propane; DL-p-Methoxy-alpha-methylphenethylamine; HSDB 7594; NSC 32757; alpha-Methyl-beta-(p-methoxyphenyl)ethylamine; p-Methoxy-alpha-methylphenethylamine; p-Methoxyamphetamine; 1-(4-Methoxybenzyl)ethylamine; Benzeneethanamine, 4-methoxy-alpha-methyl- (9CI); Phenethylamine, p-methoxy-alpha-methyl- (8CI); 1-(4-methoxyphenyl)propan-2-amine |
| Molecular Formula |
C10H15NO |
| Molecular Weight |
165.2322 |
| InChI |
InChI=1/C10H15NO/c1-8(11)7-9-3-5-10(12-2)6-4-9/h3-6,8H,7,11H2,1-2H3 |
| CAS Registry Number |
64-13-1 |
| EINECS |
200-577-0 |
| Molecular Structure |
|
| Density |
0.99g/cm3 |
| Boiling point |
258.2°C at 760 mmHg |
| Refractive index |
1.518 |
| Flash point |
107.5°C |
| Vapour Pressur |
0.0139mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|