| product Name |
3-isopropylphenyl methylcarbamate |
| Synonyms |
Phenol, 3-(1-methylethyl)-, methylcarbamate; 1PC; 3-(1-Methylethyl)phenol methylcarbamate; 3-(1-Methylethyl)phenyl methylcarbamate; 3-Isopropylphenyl methylcarbamate; 3-Isopropylphenyl-N-methylcarbamate; AC 5727; AI3-25500; BRN 2051096; Carbamic acid, N-methyl-, 3-isopropylphenyl ester; Carbamic acid, methyl-, 3-(1-methylethyl)phenyl ester; Carbamic acid, methyl-, m-cumenyl ester; Caswell No. 512A; Compound 10854; ENT 25,500; EPA Pesticide Chemical Code 047801; H 5727; H 8757; H-8,757; HER. 5727; HIP; HSDB 6376; Hercules 5727; Hercules AC 5727; Methylcarbamic acid m-cumenyl ester; N-Methyl 3-isopropylphenyl carbamate; N-Methyl carbamate, m-1-propylphenyl; N-Methyl m-isopropylphenyl carbamate; N-Methyl-3-isopropylphenyl carbamate; N-Methyl-m-isopropylphenyl carbamate; OMS 162; OMS-15; Oms-631; Phenol, m-isopropyl-, methylcarbamate; UC 10854; Union carbide 10854; Union carbide UC-10,854; m-Cumenol methylcarbamate; m-Cumenyl methylcarbamate; m-Isopropylphenol N-methylcarbamate; m-Isopropylphenyl N-methylcarbamate; m-Isopropylphenyl methylcarbamate; m-Kumenylester kyseliny methylkarbaminove; m-Kumenylester kyseliny methylkarbaminove [Czech]; Phenol, 3-(1-methylethyl)-, methylcarbamate (9CI); Phenol, 3-(1-methylethyl)-, methyl carbamate; RCRA waste no. P202; 3-(propan-2-yl)phenyl methylcarbamate |
| Molecular Formula |
C11H15NO2 |
| Molecular Weight |
193.2423 |
| InChI |
InChI=1/C11H15NO2/c1-8(2)9-5-4-6-10(7-9)14-11(13)12-3/h4-8H,1-3H3,(H,12,13) |
| CAS Registry Number |
64-00-6 |
| EINECS |
200-572-3 |
| Molecular Structure |
|
| Density |
1.039g/cm3 |
| Boiling point |
260.9°C at 760 mmHg |
| Refractive index |
1.507 |
| Flash point |
111.6°C |
| Vapour Pressur |
0.0119mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|