| product Name |
D-Lactose |
| Synonyms |
(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6R)-4,5,6-trihydroxy-2-(hydroxymethyl)tetrahydropyran-3-yl]oxy-tetrahydropyran-3,4,5-triol; D-Glucose, 4-O-beta-D-galactopyranosyl-; Milk sugar; (+)-Lactose; 4-(beta-D-Galactosido)-D-glucose; BRN 0093796; AI3-08876; 4-O-beta-D-Galactopyranosyl-D-glucose; Fast-flo Lactose; Lactin (carbohydrate); Lactose; 4-O-beta-D-galactopyranosyl-beta-D-glucopyranose; 4-O-beta-D-galactopyranosyl-D-glucopyranose |
| Molecular Formula |
C12H22O11 |
| Molecular Weight |
342.2965 |
| InChI |
InChI=1/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5+,6+,7-,8-,9-,10-,11?,12+/m1/s1 |
| CAS Registry Number |
63-42-3;1336-90-9;200734-90-3;36570-80-6;89466-76-2;73824-63-2 |
| EINECS |
200-559-2 |
| Molecular Structure |
|
| Density |
1.76g/cm3 |
| Melting point |
201-202℃ |
| Boiling point |
667.9°C at 760 mmHg |
| Refractive index |
1.652 |
| Flash point |
357.8°C |
| Water solubility |
1.95E+05 mg/L at 20℃ |
| Vapour Pressur |
1.08E-20mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|