| product Name |
sodium fluoroacetate |
| Molecular Formula |
C2H2FNaO2 |
| Molecular Weight |
100.0243 |
| InChI |
InChI=1/C2H3FO2.Na/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1 |
| CAS Registry Number |
62-74-8 |
| EINECS |
200-548-2 |
| Molecular Structure |
|
| Boiling point |
167.9°C at 760 mmHg |
| Flash point |
55.3°C |
| Vapour Pressur |
0.828mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|