| product Name |
mefenamic acid |
| Synonyms |
o-(N,N-2,3-Dimethylphenyl) Amino Benzoic Acid; N-[(2,3-DIMETHYLPHENYL)AMINO]BENZOIC ACID; N-(2,3-DIMETHYLPHENYL)ANTHRANILIC ACID; n-(2,3-xylyl)anthranilic acid; 2-((2,3-dimethyl(phenyl)amino)-benzoicaci; 2-((2,3-dimethylphenyl)amino)-benzoicaci; 2-(2,3-Dimethylanilino)benzoic acid; 2’,3’-dimethyl-2-diphenylaminecarboxylicaci; 2-Diphenylaminecarboxylic acid, 2',3'-dimethyl-; 2-[(2,3-dimethylphenyl)amino]benzoic acid |
| Molecular Formula |
C15H15NO2 |
| Molecular Weight |
241.2851 |
| InChI |
InChI=1/C15H15NO2/c1-10-6-5-9-13(11(10)2)16-14-8-4-3-7-12(14)15(17)18/h3-9,16H,1-2H3,(H,17,18) |
| CAS Registry Number |
61-68-7 |
| EINECS |
200-513-1 |
| Molecular Structure |
|
| Density |
1.203g/cm3 |
| Boiling point |
398.8°C at 760 mmHg |
| Refractive index |
1.639 |
| Flash point |
195°C |
| Vapour Pressur |
4.45E-07mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R22:;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|