| product Name |
N-ethyl-2-(1H-indol-3-yl)ethanamine |
| Synonyms |
|
| Molecular Formula |
C12H16N2 |
| Molecular Weight |
188.2688 |
| InChI |
InChI=1/C12H16N2/c1-2-13-8-7-10-9-14-12-6-4-3-5-11(10)12/h3-6,9,13-14H,2,7-8H2,1H3 |
| CAS Registry Number |
61-53-0 |
| Molecular Structure |
|
| Density |
1.066g/cm3 |
| Boiling point |
348.5°C at 760 mmHg |
| Refractive index |
1.606 |
| Flash point |
164.6°C |
| Vapour Pressur |
5E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|