| product Name |
3-(azepan-1-yl)-1-(1-benzothiophen-3-yl)propan-1-one |
| Synonyms |
|
| Molecular Formula |
C17H21NOS |
| Molecular Weight |
287.4197 |
| InChI |
InChI=1/C17H21NOS/c19-16(9-12-18-10-5-1-2-6-11-18)15-13-20-17-8-4-3-7-14(15)17/h3-4,7-8,13H,1-2,5-6,9-12H2 |
| CAS Registry Number |
61-46-1 |
| Molecular Structure |
|
| Density |
1.139g/cm3 |
| Boiling point |
451.1°C at 760 mmHg |
| Refractive index |
1.6 |
| Flash point |
226.6°C |
| Vapour Pressur |
2.5E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|