| product Name |
meticillin |
| Synonyms |
Methicillin; Staphcillin;
; (2S,5R,6R)-6-[(2,6-dimethoxybenzoyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| Molecular Formula |
C17H20N2O6S |
| Molecular Weight |
380.4155 |
| InChI |
InChI=1/C17H20N2O6S/c1-17(2)12(16(22)23)19-14(21)11(15(19)26-17)18-13(20)10-8(24-3)6-5-7-9(10)25-4/h5-7,11-12,15H,1-4H3,(H,18,20)(H,22,23)/t11-,12+,15-/m1/s1 |
| CAS Registry Number |
61-32-5 |
| EINECS |
200-505-8 |
| Molecular Structure |
|
| Density |
1.44g/cm3 |
| Boiling point |
640°C at 760 mmHg |
| Refractive index |
1.638 |
| Flash point |
340.9°C |
| Vapour Pressur |
2.94E-17mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|