| product Name |
dibucaine hydrochloride |
| Synonyms |
cinchocaine hydrochloride; 2-butoxy-n-(2-(diethylamino)ethyl)-4-quinolinecarboxamidmonohydrochlorid; 2-butoxy-n-(2-(diethylamino)ethyl)-cinchoninamidmonohydrochloride; 2-butoxy-n-(2-diethylaminoethyl)cinchoninicacidamidehydrochloride; 2-n-butoxy-n-(2-diethylaminoethyl)cinchoninamidehydrochloride; 4-Quinolinecarboxamide,2-butoxy-N-[2-(diethylamino)ethyl]-,monohydrochloride; benzolin(localanesthetic); butoxycinchoninicaciddiethylethylenediamidehydrochloride; c3225; 2-{[(2-butoxyquinolin-4-yl)carbonyl]amino}-N,N-diethylethanaminium chloride; 2-butoxy-N-[2-(diethylamino)ethyl]quinoline-4-carboxamide dihydrochloride; Dibucaine HCL |
| Molecular Formula |
C20H31Cl2N3O2 |
| Molecular Weight |
416.385 |
| InChI |
InChI=1/C20H29N3O2.2ClH/c1-4-7-14-25-19-15-17(16-10-8-9-11-18(16)22-19)20(24)21-12-13-23(5-2)6-3;;/h8-11,15H,4-7,12-14H2,1-3H3,(H,21,24);2*1H |
| CAS Registry Number |
61-12-1 |
| EINECS |
200-498-1 |
| Molecular Structure |
|
| Melting point |
99-101℃ |
| Boiling point |
544.7°C at 760 mmHg |
| Flash point |
283.2°C |
| Vapour Pressur |
3.37E-12mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R22:;
R41:;
|
| Safety Description |
S26:;
S39:;
|
|