| product Name |
methotrimeprazine maleate |
| Synonyms |
Levomepromazine base; (-)-3-(2-methoxyphenothiazin-10-yl)-2-methylpropyldimethylamine; Methotrimeprazine; Levomepromazine; (2R)-3-(2-methoxy-10H-phenothiazin-10-yl)-N,N,2-trimethylpropan-1-amine; 3-(3-methoxy-10H-phenothiazin-10-yl)-N,N,2-trimethylpropan-1-amine |
| Molecular Formula |
C19H24N2OS |
| Molecular Weight |
328.4717 |
| InChI |
InChI=1/C19H24N2OS/c1-14(12-20(2)3)13-21-16-7-5-6-8-18(16)23-19-11-15(22-4)9-10-17(19)21/h5-11,14H,12-13H2,1-4H3 |
| CAS Registry Number |
60-99-1 |
| EINECS |
200-495-5 |
| Molecular Structure |
|
| Density |
1.125g/cm3 |
| Boiling point |
468°C at 760 mmHg |
| Refractive index |
1.594 |
| Flash point |
236.8°C |
| Vapour Pressur |
6.22E-09mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|