| product Name |
Phloretin |
| Synonyms |
2',4',6'-TRIHYDROXY-3-(4-HYDROXYPHENYL)PROPIOPHENONE; 3-(4-Hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)-1-propanone; 3-(4-hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)propan-1-one; 1-(2,6-dihydroxy-4-methoxyphenyl)ethanone |
| Molecular Formula |
C9H10O4 |
| Molecular Weight |
182.1733 |
| InChI |
InChI=1/C9H10O4/c1-5(10)9-7(11)3-6(13-2)4-8(9)12/h3-4,11-12H,1-2H3 |
| CAS Registry Number |
60-82-2 |
| EINECS |
200-488-7 |
| Molecular Structure |
|
| Density |
1.284g/cm3 |
| Melting point |
260-262℃ |
| Boiling point |
356.7°C at 760 mmHg |
| Refractive index |
1.572 |
| Flash point |
146.3°C |
| Water solubility |
soluble |
| Vapour Pressur |
1.4E-05mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:;
|
| Safety Description |
S26:;
S37/39:;
|
|